C24H16FN3O3S3 — CID 18815545
(4Z)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy(phenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 18815545) has the molecular formula C24H16FN3O3S3 and a molecular weight of 509.61 g/mol. Its IUPAC name is (4Z)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy(phenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy(phenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18815545 |
| Molecular Formula | C24H16FN3O3S3 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | (4Z)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy(phenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nnc(SCc3ccc(F)cc3)s2)C(c2cccs2)/C1=C(/O)c1ccccc1 |
| InChI | InChI=1S/C24H16FN3O3S3/c25-16-10-8-14(9-11-16)13-33-24-27-26-23(34-24)28-19(17-7-4-12-32-17)18(21(30)22(28)31)20(29)15-5-2-1-3-6-15/h1-12,19,29H,13H2/b20-18- |
| InChIKey | VAOKLLOSLQEVBW-ZZEZOPTASA-N |
| XLogP | 5.66 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|