C26H20FN3O3S3 — CID 3521728
4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 3521728) has the molecular formula C26H20FN3O3S3 and a molecular weight of 537.66 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3521728 |
| Molecular Formula | C26H20FN3O3S3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(C(O)=C2C(=O)C(=O)N(c3nnc(SCc4ccc(F)cc4)s3)C2c2cccs2)c1 |
| InChI | InChI=1S/C26H20FN3O3S3/c1-14-5-6-15(2)18(12-14)22(31)20-21(19-4-3-11-34-19)30(24(33)23(20)32)25-28-29-26(36-25)35-13-16-7-9-17(27)10-8-16/h3-12,21,31H,13H2,1-2H3 |
| InChIKey | DYZQIJLPOOHIDH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|