C33H33N3O3S2 — CID 3482687
5-(4-tert-butylphenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione (PubChem CID 3482687) has the molecular formula C33H33N3O3S2 and a molecular weight of 583.78 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione.
| Compound Name | 5-(4-tert-butylphenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3482687 |
| Molecular Formula | C33H33N3O3S2 |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 5-(4-tert-butylphenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(CSc2nnc(N3C(=O)C(=O)C(=C(O)c4cc(C)ccc4C)C3c3ccc(C(C)(C)C)cc3)s2)cc1 |
| InChI | InChI=1S/C33H33N3O3S2/c1-19-8-11-22(12-9-19)18-40-32-35-34-31(41-32)36-27(23-13-15-24(16-14-23)33(4,5)6)26(29(38)30(36)39)28(37)25-17-20(2)7-10-21(25)3/h7-17,27,37H,18H2,1-6H3 |
| InChIKey | LGVWPTVBMNFYIZ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|