C36H31N3O4S2 — CID 3487544
4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 3487544) has the molecular formula C36H31N3O4S2 and a molecular weight of 633.80 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3487544 |
| Molecular Formula | C36H31N3O4S2 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.18 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(CSc2nnc(N3C(=O)C(=O)C(=C(O)c4cc(C)ccc4C)C3c3ccc(OCc4ccccc4)cc3)s2)cc1 |
| InChI | InChI=1S/C36H31N3O4S2/c1-22-10-13-26(14-11-22)21-44-36-38-37-35(45-36)39-31(27-15-17-28(18-16-27)43-20-25-7-5-4-6-8-25)30(33(41)34(39)42)32(40)29-19-23(2)9-12-24(29)3/h4-19,31,40H,20-21H2,1-3H3 |
| InChIKey | QIYKBFITSTZCBV-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|