C27H19Cl2N3O4S2 — CID 18816024
(4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 18816024) has the molecular formula C27H19Cl2N3O4S2 and a molecular weight of 584.51 g/mol. Its IUPAC name is (4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18816024 |
| Molecular Formula | C27H19Cl2N3O4S2 |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 583.02 |
| IUPAC Name | (4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(/C(O)=C2/C(=O)C(=O)N(c3nnc(SCc4ccc(Cl)cc4Cl)s3)C2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H19Cl2N3O4S2/c1-14-2-4-16(5-3-14)23(34)21-22(15-7-10-19(33)11-8-15)32(25(36)24(21)35)26-30-31-27(38-26)37-13-17-6-9-18(28)12-20(17)29/h2-12,22,33-34H,13H2,1H3/b23-21- |
| InChIKey | GLJVNOAPBKWHTB-LNVKXUELSA-N |
| XLogP | 6.78 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|