C26H15Cl3FN3O3S2 — CID 18816090
(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 18816090) has the molecular formula C26H15Cl3FN3O3S2 and a molecular weight of 606.92 g/mol. Its IUPAC name is (4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18816090 |
| Molecular Formula | C26H15Cl3FN3O3S2 |
| Molecular Weight | 606.92 g/mol |
| Exact Mass | 604.96 |
| IUPAC Name | (4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nnc(SCc3ccc(Cl)cc3Cl)s2)C(c2ccc(F)cc2)/C1=C(/O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H15Cl3FN3O3S2/c27-16-6-1-14(2-7-16)22(34)20-21(13-4-9-18(30)10-5-13)33(24(36)23(20)35)25-31-32-26(38-25)37-12-15-3-8-17(28)11-19(15)29/h1-11,21,34H,12H2/b22-20- |
| InChIKey | JSCWETMBTZIPFK-XDOYNYLZSA-N |
| XLogP | 7.56 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.92 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|