C27H21N3O4S2 — CID 18816713
(5E)-3-[(4-methoxyphenyl)methyl]-5-[[2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18816713) has the molecular formula C27H21N3O4S2 and a molecular weight of 515.62 g/mol. Its IUPAC name is (5E)-3-[(4-methoxyphenyl)methyl]-5-[[2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(4-methoxyphenyl)methyl]-5-[[2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18816713 |
| Molecular Formula | C27H21N3O4S2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | (5E)-3-[(4-methoxyphenyl)methyl]-5-[[2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)/C(=C\c3c(Oc4cccc(C)c4)nc4ccccn4c3=O)SC2=S)cc1 |
| InChI | InChI=1S/C27H21N3O4S2/c1-17-6-5-7-20(14-17)34-24-21(25(31)29-13-4-3-8-23(29)28-24)15-22-26(32)30(27(35)36-22)16-18-9-11-19(33-2)12-10-18/h3-15H,16H2,1-2H3/b22-15+ |
| InChIKey | QJEXYCHVBSBORZ-PXLXIMEGSA-N |
| XLogP | 5.21 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|