C26H26N4O3S2 — CID 3734660
5-[[2-(cyclohexylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3734660) has the molecular formula C26H26N4O3S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 5-[[2-(cyclohexylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-(cyclohexylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3734660 |
| Molecular Formula | C26H26N4O3S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 5-[[2-(cyclohexylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)C(=Cc3c(NC4CCCCC4)nc4ccccn4c3=O)SC2=S)cc1 |
| InChI | InChI=1S/C26H26N4O3S2/c1-33-19-12-10-17(11-13-19)16-30-25(32)21(35-26(30)34)15-20-23(27-18-7-3-2-4-8-18)28-22-9-5-6-14-29(22)24(20)31/h5-6,9-15,18,27H,2-4,7-8,16H2,1H3 |
| InChIKey | NFCFOJNQUQODKX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|