C26H25N3O5S2 — CID 18817351
3-[(5E)-5-[[9-methyl-2-(5-methyl-2-propan-2-ylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 18817351) has the molecular formula C26H25N3O5S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 3-[(5E)-5-[[9-methyl-2-(5-methyl-2-propan-2-ylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5E)-5-[[9-methyl-2-(5-methyl-2-propan-2-ylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 18817351 |
| Molecular Formula | C26H25N3O5S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 3-[(5E)-5-[[9-methyl-2-(5-methyl-2-propan-2-ylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | Cc1ccc(C(C)C)c(Oc2nc3c(C)cccn3c(=O)c2/C=C2/SC(=S)N(CCC(=O)O)C2=O)c1 |
| InChI | InChI=1S/C26H25N3O5S2/c1-14(2)17-8-7-15(3)12-19(17)34-23-18(24(32)28-10-5-6-16(4)22(28)27-23)13-20-25(33)29(26(35)36-20)11-9-21(30)31/h5-8,10,12-14H,9,11H2,1-4H3,(H,30,31)/b20-13+ |
| InChIKey | PNVJIJXYHBLFFR-DEDYPNTBSA-N |
| XLogP | 4.90 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|