C26H26ClNO5 — CID 18820184
1-(3-butoxyphenyl)-7-chloro-2-(oxolan-2-ylmethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18820184) has the molecular formula C26H26ClNO5 and a molecular weight of 467.95 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-7-chloro-2-(oxolan-2-ylmethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-butoxyphenyl)-7-chloro-2-(oxolan-2-ylmethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18820184 |
| Molecular Formula | C26H26ClNO5 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-(3-butoxyphenyl)-7-chloro-2-(oxolan-2-ylmethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2CC2CCCO2)c1 |
| InChI | InChI=1S/C26H26ClNO5/c1-2-3-11-31-18-7-4-6-16(13-18)23-22-24(29)20-14-17(27)9-10-21(20)33-25(22)26(30)28(23)15-19-8-5-12-32-19/h4,6-7,9-10,13-14,19,23H,2-3,5,8,11-12,15H2,1H3 |
| InChIKey | PIVMFWSAJQOGSI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|