C29H26ClNO4 — CID 18853620
1-(3-butoxyphenyl)-7-chloro-2-(4-ethylphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18853620) has the molecular formula C29H26ClNO4 and a molecular weight of 487.98 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-7-chloro-2-(4-ethylphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-butoxyphenyl)-7-chloro-2-(4-ethylphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18853620 |
| Molecular Formula | C29H26ClNO4 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 1-(3-butoxyphenyl)-7-chloro-2-(4-ethylphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2c2ccc(CC)cc2)c1 |
| InChI | InChI=1S/C29H26ClNO4/c1-3-5-15-34-22-8-6-7-19(16-22)26-25-27(32)23-17-20(30)11-14-24(23)35-28(25)29(33)31(26)21-12-9-18(4-2)10-13-21/h6-14,16-17,26H,3-5,15H2,1-2H3 |
| InChIKey | RJXPNUPGXPPPGQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|