C31H22N6O4S — CID 18821489
(5Z)-5-[[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylidene]-2-[(E)-2-(4-prop-2-enoxyphenyl)ethenyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 18821489) has the molecular formula C31H22N6O4S and a molecular weight of 574.62 g/mol. Its IUPAC name is (5Z)-5-[[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylidene]-2-[(E)-2-(4-prop-2-enoxyphenyl)ethenyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-5-[[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylidene]-2-[(E)-2-(4-prop-2-enoxyphenyl)ethenyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 18821489 |
| Molecular Formula | C31H22N6O4S |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | (5Z)-5-[[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylidene]-2-[(E)-2-(4-prop-2-enoxyphenyl)ethenyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | C=CCOc1ccc(/C=C/c2nc3s/c(=C\c4cn(-c5ccc([N+](=O)[O-])cc5)nc4-c4ccccc4)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C31H22N6O4S/c1-2-18-41-26-15-8-21(9-16-26)10-17-28-32-31-36(33-28)30(38)27(42-31)19-23-20-35(24-11-13-25(14-12-24)37(39)40)34-29(23)22-6-4-3-5-7-22/h2-17,19-20H,1,18H2/b17-10+,27-19- |
| InChIKey | AXZDKRLJZUGZPW-XRSANKSGSA-N |
| XLogP | 5.19 |
| TPSA | 117.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|