C17H14N6O3S — CID 18821910
7-(2-hydroxyethyl)-6-imino-2-oxo-N-(1,3-thiazol-2-yl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18821910) has the molecular formula C17H14N6O3S and a molecular weight of 382.41 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-6-imino-2-oxo-N-(1,3-thiazol-2-yl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 7-(2-hydroxyethyl)-6-imino-2-oxo-N-(1,3-thiazol-2-yl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18821910 |
| Molecular Formula | C17H14N6O3S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 7-(2-hydroxyethyl)-6-imino-2-oxo-N-(1,3-thiazol-2-yl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)Nc2nccs2)cc2c(=O)n3ccccc3nc2n1CCO |
| InChI | InChI=1S/C17H14N6O3S/c18-13-10(15(25)21-17-19-4-8-27-17)9-11-14(23(13)6-7-24)20-12-3-1-2-5-22(12)16(11)26/h1-5,8-9,18,24H,6-7H2,(H,19,21,25)/b18-13+ |
| InChIKey | HVAJZTHOOVGGLL-QGOAFFKASA-N |
| XLogP | 0.83 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|