C24H24N6O4S — CID 18821916
7-(2-hydroxyethyl)-6-imino-N-[3-(methylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18821916) has the molecular formula C24H24N6O4S and a molecular weight of 492.56 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-6-imino-N-[3-(methylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 7-(2-hydroxyethyl)-6-imino-N-[3-(methylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18821916 |
| Molecular Formula | C24H24N6O4S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 7-(2-hydroxyethyl)-6-imino-N-[3-(methylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1/c(C(=O)Nc2sc3c(c2C(=O)NC)CCCC3)cc2c(=O)n3ccccc3nc2n1CCO |
| InChI | InChI=1S/C24H24N6O4S/c1-26-22(33)18-13-6-2-3-7-16(13)35-23(18)28-21(32)14-12-15-20(30(10-11-31)19(14)25)27-17-8-4-5-9-29(17)24(15)34/h4-5,8-9,12,25,31H,2-3,6-7,10-11H2,1H3,(H,26,33)(H,28,32)/b25-19- |
| InChIKey | IKMDGTJIFJYXJJ-PLRJNAJWSA-N |
| XLogP | 1.67 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|