C25H25N5O4S — CID 18822074
ethyl 2-[(6-imino-7,11-dimethyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18822074) has the molecular formula C25H25N5O4S and a molecular weight of 491.57 g/mol. Its IUPAC name is ethyl 2-[(6-imino-7,11-dimethyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(6-imino-7,11-dimethyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18822074 |
| Molecular Formula | C25H25N5O4S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | ethyl 2-[(6-imino-7,11-dimethyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | [H]/N=c1/c(C(=O)Nc2sc3c(c2C(=O)OCC)CCCC3)cc2c(=O)n3cccc(C)c3nc2n1C |
| InChI | InChI=1S/C25H25N5O4S/c1-4-34-25(33)18-14-9-5-6-10-17(14)35-23(18)28-22(31)15-12-16-21(29(3)19(15)26)27-20-13(2)8-7-11-30(20)24(16)32/h7-8,11-12,26H,4-6,9-10H2,1-3H3,(H,28,31)/b26-19- |
| InChIKey | FLMVBDCCSUEZBI-XHPQRKPJSA-N |
| XLogP | 3.34 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|