C31H29N5O4S — CID 18821712
ethyl 2-[[6-imino-2-oxo-7-(2-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18821712) has the molecular formula C31H29N5O4S and a molecular weight of 567.67 g/mol. Its IUPAC name is ethyl 2-[[6-imino-2-oxo-7-(2-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[6-imino-2-oxo-7-(2-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18821712 |
| Molecular Formula | C31H29N5O4S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | ethyl 2-[[6-imino-2-oxo-7-(2-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | [H]/N=c1\c(C(=O)Nc2sc3c(c2C(=O)OCC)CCCC3)cc2c(=O)n3ccccc3nc2n1CCc1ccccc1 |
| InChI | InChI=1S/C31H29N5O4S/c1-2-40-31(39)25-20-12-6-7-13-23(20)41-29(25)34-28(37)21-18-22-27(33-24-14-8-9-16-35(24)30(22)38)36(26(21)32)17-15-19-10-4-3-5-11-19/h3-5,8-11,14,16,18,32H,2,6-7,12-13,15,17H2,1H3,(H,34,37)/b32-26+ |
| InChIKey | MKWPEBAJCKUHRT-HMZBKAONSA-N |
| XLogP | 4.74 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|