C25H23N5O4S — CID 18821834
methyl 2-[(6-imino-2-oxo-7-prop-2-enyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18821834) has the molecular formula C25H23N5O4S and a molecular weight of 489.56 g/mol. Its IUPAC name is methyl 2-[(6-imino-2-oxo-7-prop-2-enyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(6-imino-2-oxo-7-prop-2-enyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18821834 |
| Molecular Formula | C25H23N5O4S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | methyl 2-[(6-imino-2-oxo-7-prop-2-enyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | [H]/N=c1\c(C(=O)Nc2sc3c(c2C(=O)OC)CCCC3)cc2c(=O)n3ccccc3nc2n1CC=C |
| InChI | InChI=1S/C25H23N5O4S/c1-3-11-30-20(26)15(13-16-21(30)27-18-10-6-7-12-29(18)24(16)32)22(31)28-23-19(25(33)34-2)14-8-4-5-9-17(14)35-23/h3,6-7,10,12-13,26H,1,4-5,8-9,11H2,2H3,(H,28,31)/b26-20+ |
| InChIKey | LBCHKFOBUAMJDU-LHLOQNFPSA-N |
| XLogP | 3.29 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|