C16H17N3O2 — CID 18822634
2-(2-methoxyphenyl)-5-piperidin-1-yl-1,3-oxazole-4-carbonitrile (PubChem CID 18822634) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-5-piperidin-1-yl-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-(2-methoxyphenyl)-5-piperidin-1-yl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 18822634 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-(2-methoxyphenyl)-5-piperidin-1-yl-1,3-oxazole-4-carbonitrile |
| SMILES | COc1ccccc1-c1nc(C#N)c(N2CCCCC2)o1 |
| InChI | InChI=1S/C16H17N3O2/c1-20-14-8-4-3-7-12(14)15-18-13(11-17)16(21-15)19-9-5-2-6-10-19/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | NWSCAWKMTLSVPI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |