C16H17FN2O3S — CID 18824526
2-[2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]ethyl acetate (PubChem CID 18824526) has the molecular formula C16H17FN2O3S and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]ethyl acetate.
| Compound Name | 2-[2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]ethyl acetate |
|---|---|
| PubChem CID | 18824526 |
| Molecular Formula | C16H17FN2O3S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]ethyl acetate |
| SMILES | C=CCN1C(=O)C(CCOC(C)=O)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN2O3S/c1-3-9-19-15(21)14(8-10-22-11(2)20)23-16(19)18-13-6-4-12(17)5-7-13/h3-7,14H,1,8-10H2,2H3/b18-16- |
| InChIKey | NQTCMGFYYXFIJG-VLGSPTGOSA-N |
| XLogP | 2.90 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|