About 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine
4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine (PubChem CID 18825718) has the molecular formula C24H22N2O3S
and a molecular weight of 418.52 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine |
| PubChem CID | 18825718 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine |
| SMILES | Cc1cc(C)cc(Nc2oc(-c3cccc(C)c3)nc2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H22N2O3S/c1-16-8-7-9-19(13-16)22-26-24(30(27,28)21-10-5-4-6-11-21)23(29-22)25-20-14-17(2)12-18(3)15-20/h4-15,25H,1-3H3 |
| InChIKey | SBRQDWVRGVFALV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine?
The IUPAC name of 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine (CID 18825718) is 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine.
What is the SMILES notation for 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine?
The canonical SMILES for 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine is Cc1cc(C)cc(Nc2oc(-c3cccc(C)c3)nc2S(=O)(=O)c2ccccc2)c1.
What is the InChIKey of 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine?
The InChIKey is SBRQDWVRGVFALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O3S/c1-16-8-7-9-19(13-16)22-26-24(30(27,28)21-10-5-4-6-11-21)23(29-22)25-20-14-17(2)12-18(3)15-20/h4-15,25H,1-3H3.
What are the key properties of 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine?
4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine has a molecular weight of 418.52 g/mol, XLogP of 5.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfonyl)-N-(3,5-dimethylphenyl)-2-(3-methylphenyl)-1,3-oxazol-5-amine is sourced from PubChem (CID 18825718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).