C22H18N2O4S — CID 18825622
4-(benzenesulfonyl)-N-(3-methoxyphenyl)-2-phenyl-1,3-oxazol-5-amine (PubChem CID 18825622) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(3-methoxyphenyl)-2-phenyl-1,3-oxazol-5-amine.
| Compound Name | 4-(benzenesulfonyl)-N-(3-methoxyphenyl)-2-phenyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18825622 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(3-methoxyphenyl)-2-phenyl-1,3-oxazol-5-amine |
| SMILES | COc1cccc(Nc2oc(-c3ccccc3)nc2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H18N2O4S/c1-27-18-12-8-11-17(15-18)23-21-22(29(25,26)19-13-6-3-7-14-19)24-20(28-21)16-9-4-2-5-10-16/h2-15,23H,1H3 |
| InChIKey | SSOZUXBXLLDJMV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |