C32H28ClN3O3S — CID 18826518
4-(benzenesulfonyl)-5-(4-benzhydrylpiperazin-1-yl)-2-(2-chlorophenyl)-1,3-oxazole (PubChem CID 18826518) has the molecular formula C32H28ClN3O3S and a molecular weight of 570.11 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-(4-benzhydrylpiperazin-1-yl)-2-(2-chlorophenyl)-1,3-oxazole.
| Compound Name | 4-(benzenesulfonyl)-5-(4-benzhydrylpiperazin-1-yl)-2-(2-chlorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 18826518 |
| Molecular Formula | C32H28ClN3O3S |
| Molecular Weight | 570.11 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | 4-(benzenesulfonyl)-5-(4-benzhydrylpiperazin-1-yl)-2-(2-chlorophenyl)-1,3-oxazole |
| SMILES | O=S(=O)(c1ccccc1)c1nc(-c2ccccc2Cl)oc1N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H28ClN3O3S/c33-28-19-11-10-18-27(28)30-34-31(40(37,38)26-16-8-3-9-17-26)32(39-30)36-22-20-35(21-23-36)29(24-12-4-1-5-13-24)25-14-6-2-7-15-25/h1-19,29H,20-23H2 |
| InChIKey | XXBXEBNZQLXQQY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.11 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |