C30H27N3O3S2 — CID 5267221
4-(benzenesulfonyl)-5-(4-benzhydrylpiperazin-1-yl)-2-thiophen-2-yl-1,3-oxazole (PubChem CID 5267221) has the molecular formula C30H27N3O3S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-(4-benzhydrylpiperazin-1-yl)-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-(benzenesulfonyl)-5-(4-benzhydrylpiperazin-1-yl)-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 5267221 |
| Molecular Formula | C30H27N3O3S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 4-(benzenesulfonyl)-5-(4-benzhydrylpiperazin-1-yl)-2-thiophen-2-yl-1,3-oxazole |
| SMILES | O=S(=O)(c1ccccc1)c1nc(-c2cccs2)oc1N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H27N3O3S2/c34-38(35,25-15-8-3-9-16-25)29-30(36-28(31-29)26-17-10-22-37-26)33-20-18-32(19-21-33)27(23-11-4-1-5-12-23)24-13-6-2-7-14-24/h1-17,22,27H,18-21H2 |
| InChIKey | DQYILMDPONCYJG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |