C19H19FN2O3S2 — CID 5267327
5-(azepan-1-yl)-4-(4-fluorophenyl)sulfonyl-2-thiophen-2-yl-1,3-oxazole (PubChem CID 5267327) has the molecular formula C19H19FN2O3S2 and a molecular weight of 406.50 g/mol. Its IUPAC name is 5-(azepan-1-yl)-4-(4-fluorophenyl)sulfonyl-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 5-(azepan-1-yl)-4-(4-fluorophenyl)sulfonyl-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 5267327 |
| Molecular Formula | C19H19FN2O3S2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 5-(azepan-1-yl)-4-(4-fluorophenyl)sulfonyl-2-thiophen-2-yl-1,3-oxazole |
| SMILES | O=S(=O)(c1ccc(F)cc1)c1nc(-c2cccs2)oc1N1CCCCCC1 |
| InChI | InChI=1S/C19H19FN2O3S2/c20-14-7-9-15(10-8-14)27(23,24)18-19(22-11-3-1-2-4-12-22)25-17(21-18)16-6-5-13-26-16/h5-10,13H,1-4,11-12H2 |
| InChIKey | UCMYFNDVJZYPBP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |