C15H13NO4S2 — CID 14931733
4-(benzenesulfonyl)-5-ethoxy-2-thiophen-2-yl-1,3-oxazole (PubChem CID 14931733) has the molecular formula C15H13NO4S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-ethoxy-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-(benzenesulfonyl)-5-ethoxy-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 14931733 |
| Molecular Formula | C15H13NO4S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 4-(benzenesulfonyl)-5-ethoxy-2-thiophen-2-yl-1,3-oxazole |
| SMILES | CCOc1oc(-c2cccs2)nc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13NO4S2/c1-2-19-15-14(16-13(20-15)12-9-6-10-21-12)22(17,18)11-7-4-3-5-8-11/h3-10H,2H2,1H3 |
| InChIKey | NIXGFSSXAQOZSH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |