C23H27N3O — CID 18827474
N-cyclohexyl-4-(2-pyridin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18827474) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is N-cyclohexyl-4-(2-pyridin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-cyclohexyl-4-(2-pyridin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18827474 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | N-cyclohexyl-4-(2-pyridin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccccn2)[nH]c2ccccc12)NC1CCCCC1 |
| InChI | InChI=1S/C23H27N3O/c27-22(25-17-9-2-1-3-10-17)15-8-12-19-18-11-4-5-13-20(18)26-23(19)21-14-6-7-16-24-21/h4-7,11,13-14,16-17,26H,1-3,8-10,12,15H2,(H,25,27) |
| InChIKey | FGTMMNBXGPWAMO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|