C22H18ClF3N2O4S — CID 18827760
N-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-2-(2-ethoxy-4-formylphenoxy)acetamide (PubChem CID 18827760) has the molecular formula C22H18ClF3N2O4S and a molecular weight of 498.91 g/mol. Its IUPAC name is N-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-2-(2-ethoxy-4-formylphenoxy)acetamide.
| Compound Name | N-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-2-(2-ethoxy-4-formylphenoxy)acetamide |
|---|---|
| PubChem CID | 18827760 |
| Molecular Formula | C22H18ClF3N2O4S |
| Molecular Weight | 498.91 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | N-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-2-(2-ethoxy-4-formylphenoxy)acetamide |
| SMILES | CCOc1cc(C=O)ccc1OCC(=O)Nc1ncc(Cc2cc(C(F)(F)F)ccc2Cl)s1 |
| InChI | InChI=1S/C22H18ClF3N2O4S/c1-2-31-19-7-13(11-29)3-6-18(19)32-12-20(30)28-21-27-10-16(33-21)9-14-8-15(22(24,25)26)4-5-17(14)23/h3-8,10-11H,2,9,12H2,1H3,(H,27,28,30) |
| InChIKey | NAOAVBIKUXRENV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.91 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|