C23H18FN3O5S — CID 18829176
methyl 4-[(3E)-1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-[(4-fluorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 18829176) has the molecular formula C23H18FN3O5S and a molecular weight of 467.48 g/mol. Its IUPAC name is methyl 4-[(3E)-1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-[(4-fluorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(3E)-1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-[(4-fluorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 18829176 |
| Molecular Formula | C23H18FN3O5S |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | methyl 4-[(3E)-1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-[(4-fluorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | CCc1nnc(N2C(=O)C(=O)/C(=C(/O)c3ccc(F)cc3)C2c2ccc(C(=O)OC)cc2)s1 |
| InChI | InChI=1S/C23H18FN3O5S/c1-3-16-25-26-23(33-16)27-18(12-4-6-14(7-5-12)22(31)32-2)17(20(29)21(27)30)19(28)13-8-10-15(24)11-9-13/h4-11,18,28H,3H2,1-2H3/b19-17+ |
| InChIKey | GBKOUOOIOVEAAD-HTXNQAPBSA-N |
| XLogP | 3.65 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|