C24H17FN2O5 — CID 23794178
methyl 4-[(3Z)-3-[(4-fluorophenyl)-hydroxymethylidene]-4,5-dioxo-1-pyridin-2-ylpyrrolidin-2-yl]benzoate (PubChem CID 23794178) has the molecular formula C24H17FN2O5 and a molecular weight of 432.41 g/mol. Its IUPAC name is methyl 4-[(3Z)-3-[(4-fluorophenyl)-hydroxymethylidene]-4,5-dioxo-1-pyridin-2-ylpyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(3Z)-3-[(4-fluorophenyl)-hydroxymethylidene]-4,5-dioxo-1-pyridin-2-ylpyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 23794178 |
| Molecular Formula | C24H17FN2O5 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | methyl 4-[(3Z)-3-[(4-fluorophenyl)-hydroxymethylidene]-4,5-dioxo-1-pyridin-2-ylpyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2/C(=C(/O)c3ccc(F)cc3)C(=O)C(=O)N2c2ccccn2)cc1 |
| InChI | InChI=1S/C24H17FN2O5/c1-32-24(31)16-7-5-14(6-8-16)20-19(21(28)15-9-11-17(25)12-10-15)22(29)23(30)27(20)18-4-2-3-13-26-18/h2-13,20,28H,1H3/b21-19- |
| InChIKey | ZVFGEYDMNBGGNG-VZCXRCSSSA-N |
| XLogP | 3.63 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|