C16H23NO2S2 — CID 18832150
N-butyl-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide (PubChem CID 18832150) has the molecular formula C16H23NO2S2 and a molecular weight of 325.50 g/mol. Its IUPAC name is N-butyl-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide.
| Compound Name | N-butyl-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide |
|---|---|
| PubChem CID | 18832150 |
| Molecular Formula | C16H23NO2S2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-butyl-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide |
| SMILES | CCCCNC(=O)c1oc2c(c1C)C1(CCC2)SCCS1 |
| InChI | InChI=1S/C16H23NO2S2/c1-3-4-8-17-15(18)14-11(2)13-12(19-14)6-5-7-16(13)20-9-10-21-16/h3-10H2,1-2H3,(H,17,18) |
| InChIKey | PEPZEJPPPZPWCG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|