C18H25NO5 — CID 75417868
6-[(3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbonyl)amino]hexanoic acid (PubChem CID 75417868) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 6-[(3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 75417868 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 6-[(3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbonyl)amino]hexanoic acid |
| SMILES | Cc1c(C(=O)NCCCCCC(=O)O)oc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C18H25NO5/c1-11-15-12(20)9-18(2,3)10-13(15)24-16(11)17(23)19-8-6-4-5-7-14(21)22/h4-10H2,1-3H3,(H,19,23)(H,21,22) |
| InChIKey | IXIRBPIHYNZPEI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|