C18H24N2O5 — CID 119219815
6-[(7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carbonyl)amino]hexanoic acid (PubChem CID 119219815) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 6-[(7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 119219815 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 6-[(7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carbonyl)amino]hexanoic acid |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)NCCCCCC(=O)O)c(=O)[nH]c2C1 |
| InChI | InChI=1S/C18H24N2O5/c1-18(2)9-13-11(14(21)10-18)8-12(17(25)20-13)16(24)19-7-5-3-4-6-15(22)23/h8H,3-7,9-10H2,1-2H3,(H,19,24)(H,20,25)(H,22,23) |
| InChIKey | KQIPQSRMSWAPDP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|