C25H32N4O3 — CID 56565626
7,7-dimethyl-2,5-dioxo-N-[3-(4-phenylpiperazin-1-yl)propyl]-6,8-dihydro-1H-quinoline-3-carboxamide (PubChem CID 56565626) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 7,7-dimethyl-2,5-dioxo-N-[3-(4-phenylpiperazin-1-yl)propyl]-6,8-dihydro-1H-quinoline-3-carboxamide.
| Compound Name | 7,7-dimethyl-2,5-dioxo-N-[3-(4-phenylpiperazin-1-yl)propyl]-6,8-dihydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 56565626 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 7,7-dimethyl-2,5-dioxo-N-[3-(4-phenylpiperazin-1-yl)propyl]-6,8-dihydro-1H-quinoline-3-carboxamide |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)NCCCN3CCN(c4ccccc4)CC3)c(=O)[nH]c2C1 |
| InChI | InChI=1S/C25H32N4O3/c1-25(2)16-21-19(22(30)17-25)15-20(24(32)27-21)23(31)26-9-6-10-28-11-13-29(14-12-28)18-7-4-3-5-8-18/h3-5,7-8,15H,6,9-14,16-17H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | NLIGFQKWPQKHHJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|