C25H32N4O3 — CID 56559994
N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide (PubChem CID 56559994) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 56559994 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cc4c([nH]c3=O)CC(C)(C)CC4=O)c(C)c2)CC1 |
| InChI | InChI=1S/C25H32N4O3/c1-5-28-8-10-29(11-9-28)17-6-7-20(16(2)12-17)26-23(31)19-13-18-21(27-24(19)32)14-25(3,4)15-22(18)30/h6-7,12-13H,5,8-11,14-15H2,1-4H3,(H,26,31)(H,27,32) |
| InChIKey | KPVLGEZBPGFXHM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|