C23H30N4O2 — CID 24571066
N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide (PubChem CID 24571066) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 24571066 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3[nH]c4c(c3C)C(=O)CCC4)c(C)c2)CC1 |
| InChI | InChI=1S/C23H30N4O2/c1-4-26-10-12-27(13-11-26)17-8-9-18(15(2)14-17)25-23(29)22-16(3)21-19(24-22)6-5-7-20(21)28/h8-9,14,24H,4-7,10-13H2,1-3H3,(H,25,29) |
| InChIKey | DILLVJILLSKODL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|