About N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide
N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 18834318) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide |
| PubChem CID | 18834318 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)C2CCC1(C(=O)NC1CCCC1)C(=O)C2=O |
| InChI | InChI=1S/C15H21NO3/c1-14(2)10-7-8-15(14,12(18)11(10)17)13(19)16-9-5-3-4-6-9/h9-10H,3-8H2,1-2H3,(H,16,19) |
| InChIKey | ZVMYPQGKFFMJAQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide?
The IUPAC name of N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide (CID 18834318) is N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide.
What is the SMILES notation for N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide?
The canonical SMILES for N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide is CC1(C)C2CCC1(C(=O)NC1CCCC1)C(=O)C2=O.
What is the InChIKey of N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide?
The InChIKey is ZVMYPQGKFFMJAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-14(2)10-7-8-15(14,12(18)11(10)17)13(19)16-9-5-3-4-6-9/h9-10H,3-8H2,1-2H3,(H,16,19).
What are the key properties of N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide?
N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide has a molecular weight of 263.34 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide is sourced from PubChem (CID 18834318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).