C15H21NO3 — CID 18834318
N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 18834318) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 18834318 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-cyclopentyl-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)C2CCC1(C(=O)NC1CCCC1)C(=O)C2=O |
| InChI | InChI=1S/C15H21NO3/c1-14(2)10-7-8-15(14,12(18)11(10)17)13(19)16-9-5-3-4-6-9/h9-10H,3-8H2,1-2H3,(H,16,19) |
| InChIKey | ZVMYPQGKFFMJAQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|