C20H22FNO3 — CID 18834355
1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 18834355) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 18834355 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | CC1CCc2cc(F)ccc2N1C(=O)C12CCC(C(=O)C1=O)C2(C)C |
| InChI | InChI=1S/C20H22FNO3/c1-11-4-5-12-10-13(21)6-7-15(12)22(11)18(25)20-9-8-14(19(20,2)3)16(23)17(20)24/h6-7,10-11,14H,4-5,8-9H2,1-3H3 |
| InChIKey | WEUZSEBASOSTIJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|