C18H18Cl2O4 — CID 18835052
(2,4-dichlorophenyl) 4-hydroxy-3,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-2-carboxylate (PubChem CID 18835052) has the molecular formula C18H18Cl2O4 and a molecular weight of 369.24 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 4-hydroxy-3,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-2-carboxylate.
| Compound Name | (2,4-dichlorophenyl) 4-hydroxy-3,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 18835052 |
| Molecular Formula | C18H18Cl2O4 |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (2,4-dichlorophenyl) 4-hydroxy-3,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc(Cl)cc2Cl)oc2c1C(O)CC(C)(C)C2 |
| InChI | InChI=1S/C18H18Cl2O4/c1-9-15-12(21)7-18(2,3)8-14(15)23-16(9)17(22)24-13-5-4-10(19)6-11(13)20/h4-6,12,21H,7-8H2,1-3H3 |
| InChIKey | ZIZWCOPYHCAXOV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|