C15H23NO4 — CID 27307692
(4R)-4-hydroxy-N-(2-methoxyethyl)-3,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-2-carboxamide (PubChem CID 27307692) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (4R)-4-hydroxy-N-(2-methoxyethyl)-3,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-2-carboxamide.
| Compound Name | (4R)-4-hydroxy-N-(2-methoxyethyl)-3,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 27307692 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (4R)-4-hydroxy-N-(2-methoxyethyl)-3,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-2-carboxamide |
| SMILES | COCCNC(=O)c1oc2c(c1C)[C@H](O)CC(C)(C)C2 |
| InChI | InChI=1S/C15H23NO4/c1-9-12-10(17)7-15(2,3)8-11(12)20-13(9)14(18)16-5-6-19-4/h10,17H,5-8H2,1-4H3,(H,16,18)/t10-/m1/s1 |
| InChIKey | CKSLXHISCYJMLJ-SNVBAGLBSA-N |
| XLogP | 1.97 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|