C17H26N4O4 — CID 18835695
(4Z)-4-(carbamoylhydrazinylidene)-N-(1-methoxypropan-2-yl)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 18835695) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is (4Z)-4-(carbamoylhydrazinylidene)-N-(1-methoxypropan-2-yl)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (4Z)-4-(carbamoylhydrazinylidene)-N-(1-methoxypropan-2-yl)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18835695 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (4Z)-4-(carbamoylhydrazinylidene)-N-(1-methoxypropan-2-yl)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | COCC(C)NC(=O)c1oc2c(c1C)/C(=N\NC(N)=O)CC(C)(C)C2 |
| InChI | InChI=1S/C17H26N4O4/c1-9(8-24-5)19-15(22)14-10(2)13-11(20-21-16(18)23)6-17(3,4)7-12(13)25-14/h9H,6-8H2,1-5H3,(H,19,22)(H3,18,21,23)/b20-11- |
| InChIKey | XTTNQVIHPPPPLT-JAIQZWGSSA-N |
| XLogP | 1.70 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|