C19H29N2O4+ — CID 7372164
3,6,6-trimethyl-N-(3-morpholin-4-ium-4-ylpropyl)-4-oxo-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 7372164) has the molecular formula C19H29N2O4+ and a molecular weight of 349.45 g/mol. Its IUPAC name is 3,6,6-trimethyl-N-(3-morpholin-4-ium-4-ylpropyl)-4-oxo-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 3,6,6-trimethyl-N-(3-morpholin-4-ium-4-ylpropyl)-4-oxo-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7372164 |
| Molecular Formula | C19H29N2O4+ |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 3,6,6-trimethyl-N-(3-morpholin-4-ium-4-ylpropyl)-4-oxo-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCC[NH+]2CCOCC2)oc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C19H28N2O4/c1-13-16-14(22)11-19(2,3)12-15(16)25-17(13)18(23)20-5-4-6-21-7-9-24-10-8-21/h4-12H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | KCAFFBUYTONTGI-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|