About (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate
(4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate (PubChem CID 18837712) has the molecular formula C25H25NO5
and a molecular weight of 419.48 g/mol. Its IUPAC name is (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate.
Molecular Properties
| Compound Name | (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate |
| PubChem CID | 18837712 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate |
| SMILES | CCN(CC)C(=O)c1ccc(OCC(=O)Oc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H25NO5/c1-3-26(4-2)25(28)19-10-12-20(13-11-19)29-18-24(27)31-23-16-14-22(15-17-23)30-21-8-6-5-7-9-21/h5-17H,3-4,18H2,1-2H3 |
| InChIKey | UDSCYOZPSSDKQU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate?
The IUPAC name of (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate (CID 18837712) is (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate.
What is the SMILES notation for (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate?
The canonical SMILES for (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate is CCN(CC)C(=O)c1ccc(OCC(=O)Oc2ccc(Oc3ccccc3)cc2)cc1.
What is the InChIKey of (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate?
The InChIKey is UDSCYOZPSSDKQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO5/c1-3-26(4-2)25(28)19-10-12-20(13-11-19)29-18-24(27)31-23-16-14-22(15-17-23)30-21-8-6-5-7-9-21/h5-17H,3-4,18H2,1-2H3.
What are the key properties of (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate?
(4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate has a molecular weight of 419.48 g/mol, XLogP of 4.95, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenoxyphenyl) 2-[4-(diethylcarbamoyl)phenoxy]acetate is sourced from PubChem (CID 18837712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).