C29H24N4O6 — CID 18838628
ethyl 4-[[(Z)-2-cyano-3-[2-(2-methoxyphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoyl]amino]benzoate (PubChem CID 18838628) has the molecular formula C29H24N4O6 and a molecular weight of 524.53 g/mol. Its IUPAC name is ethyl 4-[[(Z)-2-cyano-3-[2-(2-methoxyphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(Z)-2-cyano-3-[2-(2-methoxyphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 18838628 |
| Molecular Formula | C29H24N4O6 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | ethyl 4-[[(Z)-2-cyano-3-[2-(2-methoxyphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)/C(C#N)=C\c2c(Oc3ccccc3OC)nc3c(C)cccn3c2=O)cc1 |
| InChI | InChI=1S/C29H24N4O6/c1-4-38-29(36)19-11-13-21(14-12-19)31-26(34)20(17-30)16-22-27(39-24-10-6-5-9-23(24)37-3)32-25-18(2)8-7-15-33(25)28(22)35/h5-16H,4H2,1-3H3,(H,31,34)/b20-16- |
| InChIKey | NDTCULPPPJIWSK-SILNSSARSA-N |
| XLogP | 4.53 |
| TPSA | 132.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|