C27H19F3N4O4 — CID 18838626
(Z)-2-cyano-3-[2-(2-methoxyphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 18838626) has the molecular formula C27H19F3N4O4 and a molecular weight of 520.47 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(2-methoxyphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(2-methoxyphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18838626 |
| Molecular Formula | C27H19F3N4O4 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | (Z)-2-cyano-3-[2-(2-methoxyphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccccc1Oc1nc2c(C)cccn2c(=O)c1/C=C(/C#N)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H19F3N4O4/c1-16-7-6-12-34-23(16)33-25(38-22-11-4-3-10-21(22)37-2)20(26(34)36)13-17(15-31)24(35)32-19-9-5-8-18(14-19)27(28,29)30/h3-14H,1-2H3,(H,32,35)/b17-13- |
| InChIKey | LOEANONHGYQQJW-LGMDPLHJSA-N |
| XLogP | 5.37 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|