C27H22N4O4 — CID 18838410
(Z)-2-cyano-N-(2-methoxyphenyl)-3-[9-methyl-2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide (PubChem CID 18838410) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-methoxyphenyl)-3-[9-methyl-2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-methoxyphenyl)-3-[9-methyl-2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18838410 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (Z)-2-cyano-N-(2-methoxyphenyl)-3-[9-methyl-2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
| SMILES | COc1ccccc1NC(=O)/C(C#N)=C\c1c(Oc2cccc(C)c2)nc2c(C)cccn2c1=O |
| InChI | InChI=1S/C27H22N4O4/c1-17-8-6-10-20(14-17)35-26-21(27(33)31-13-7-9-18(2)24(31)30-26)15-19(16-28)25(32)29-22-11-4-5-12-23(22)34-3/h4-15H,1-3H3,(H,29,32)/b19-15- |
| InChIKey | VUDVPBAZLJJBTG-CYVLTUHYSA-N |
| XLogP | 4.66 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|