C25H16Cl2N4O3 — CID 18838238
(Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(9-methyl-4-oxo-2-phenoxypyrido[1,2-a]pyrimidin-3-yl)prop-2-enamide (PubChem CID 18838238) has the molecular formula C25H16Cl2N4O3 and a molecular weight of 491.33 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(9-methyl-4-oxo-2-phenoxypyrido[1,2-a]pyrimidin-3-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(9-methyl-4-oxo-2-phenoxypyrido[1,2-a]pyrimidin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18838238 |
| Molecular Formula | C25H16Cl2N4O3 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(9-methyl-4-oxo-2-phenoxypyrido[1,2-a]pyrimidin-3-yl)prop-2-enamide |
| SMILES | Cc1cccn2c(=O)c(/C=C(/C#N)C(=O)Nc3cccc(Cl)c3Cl)c(Oc3ccccc3)nc12 |
| InChI | InChI=1S/C25H16Cl2N4O3/c1-15-7-6-12-31-22(15)30-24(34-17-8-3-2-4-9-17)18(25(31)33)13-16(14-28)23(32)29-20-11-5-10-19(26)21(20)27/h2-13H,1H3,(H,29,32)/b16-13- |
| InChIKey | TULLUFZTUFOFFY-SSZFMOIBSA-N |
| XLogP | 5.65 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|