C26H19FN4O3 — CID 18838487
(Z)-2-cyano-3-[2-(4-fluorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-methylphenyl)prop-2-enamide (PubChem CID 18838487) has the molecular formula C26H19FN4O3 and a molecular weight of 454.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(4-fluorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(4-fluorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18838487 |
| Molecular Formula | C26H19FN4O3 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (Z)-2-cyano-3-[2-(4-fluorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C\c1c(Oc2ccc(F)cc2)nc2c(C)cccn2c1=O |
| InChI | InChI=1S/C26H19FN4O3/c1-16-6-3-4-8-22(16)29-24(32)18(15-28)14-21-25(34-20-11-9-19(27)10-12-20)30-23-17(2)7-5-13-31(23)26(21)33/h3-14H,1-2H3,(H,29,32)/b18-14- |
| InChIKey | HGGOZHKSFKDHKP-JXAWBTAJSA-N |
| XLogP | 4.79 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|