C18H22Cl2N2OS — CID 18838764
(5Z)-3-butyl-2-butylimino-5-[(2,6-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 18838764) has the molecular formula C18H22Cl2N2OS and a molecular weight of 385.36 g/mol. Its IUPAC name is (5Z)-3-butyl-2-butylimino-5-[(2,6-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-butyl-2-butylimino-5-[(2,6-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18838764 |
| Molecular Formula | C18H22Cl2N2OS |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (5Z)-3-butyl-2-butylimino-5-[(2,6-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCC/N=C1\S/C(=C\c2c(Cl)cccc2Cl)C(=O)N1CCCC |
| InChI | InChI=1S/C18H22Cl2N2OS/c1-3-5-10-21-18-22(11-6-4-2)17(23)16(24-18)12-13-14(19)8-7-9-15(13)20/h7-9,12H,3-6,10-11H2,1-2H3/b16-12-,21-18- |
| InChIKey | BDMPMPVNBGJKBF-RWZIVCILSA-N |
| XLogP | 5.87 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|