C19H24N2O3S — CID 6137232
4-[(Z)-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid (PubChem CID 6137232) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 4-[(Z)-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid.
| Compound Name | 4-[(Z)-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 6137232 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 4-[(Z)-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid |
| SMILES | CCCC/N=C1\S/C(=C\c2ccc(C(=O)O)cc2)C(=O)N1CCCC |
| InChI | InChI=1S/C19H24N2O3S/c1-3-5-11-20-19-21(12-6-4-2)17(22)16(25-19)13-14-7-9-15(10-8-14)18(23)24/h7-10,13H,3-6,11-12H2,1-2H3,(H,23,24)/b16-13-,20-19- |
| InChIKey | SUKDRUQOUUEZNG-OROSMMNWSA-N |
| XLogP | 4.26 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|