C24H19NO4S — CID 18840264
(5Z)-3-(4-hydroxyphenyl)-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 18840264) has the molecular formula C24H19NO4S and a molecular weight of 417.49 g/mol. Its IUPAC name is (5Z)-3-(4-hydroxyphenyl)-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(4-hydroxyphenyl)-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18840264 |
| Molecular Formula | C24H19NO4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (5Z)-3-(4-hydroxyphenyl)-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(COc2cccc(/C=C3\SC(=O)N(c4ccc(O)cc4)C3=O)c2)cc1 |
| InChI | InChI=1S/C24H19NO4S/c1-16-5-7-17(8-6-16)15-29-21-4-2-3-18(13-21)14-22-23(27)25(24(28)30-22)19-9-11-20(26)12-10-19/h2-14,26H,15H2,1H3/b22-14- |
| InChIKey | UOROIHJTSKQCSP-HMAPJEAMSA-N |
| XLogP | 5.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|